C16H19N5OS — CID 46625755
2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide (PubChem CID 46625755) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 46625755 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[(4-cyclopropyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1nnc(-c2cccnc2)n1C1CC1 |
| InChI | InChI=1S/C16H19N5OS/c1-3-8-18-15(22)11(2)23-16-20-19-14(21(16)13-6-7-13)12-5-4-9-17-10-12/h3-5,9-11,13H,1,6-8H2,2H3,(H,18,22) |
| InChIKey | UDHDAMPHGDSFOA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|