C23H23FN2O3 — CID 46626383
[1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-propan-2-ylquinoline-4-carboxylate (PubChem CID 46626383) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-propan-2-ylquinoline-4-carboxylate.
| Compound Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-propan-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 46626383 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-propan-2-ylquinoline-4-carboxylate |
| SMILES | CC(OC(=O)c1cc(C(C)C)nc2ccccc12)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O3/c1-14(2)21-12-19(18-6-4-5-7-20(18)26-21)23(28)29-15(3)22(27)25-13-16-8-10-17(24)11-9-16/h4-12,14-15H,13H2,1-3H3,(H,25,27) |
| InChIKey | IWBMMZCLRGKKJP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |