C21H18F3N3O4 — CID 46627435
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate (PubChem CID 46627435) has the molecular formula C21H18F3N3O4 and a molecular weight of 433.39 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 46627435 |
| Molecular Formula | C21H18F3N3O4 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] 3-(3-methyl-4-oxoquinazolin-2-yl)propanoate |
| SMILES | Cn1c(CCC(=O)OCC(=O)Nc2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H18F3N3O4/c1-27-17(26-16-8-3-2-7-15(16)20(27)30)9-10-19(29)31-12-18(28)25-14-6-4-5-13(11-14)21(22,23)24/h2-8,11H,9-10,12H2,1H3,(H,25,28) |
| InChIKey | PVPCDHONYKBGJC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |