C21H23N5O6S — CID 46628779
N-ethyl-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]acetamide (PubChem CID 46628779) has the molecular formula C21H23N5O6S and a molecular weight of 473.51 g/mol. Its IUPAC name is N-ethyl-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]acetamide.
| Compound Name | N-ethyl-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 46628779 |
| Molecular Formula | C21H23N5O6S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-ethyl-2-[4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]acetamide |
| SMILES | CCN(CC(=O)NCc1cccs1)C(=O)CN1C(=O)NC(C)(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C21H23N5O6S/c1-3-24(12-17(27)22-11-16-5-4-10-33-16)18(28)13-25-19(29)21(2,23-20(25)30)14-6-8-15(9-7-14)26(31)32/h4-10H,3,11-13H2,1-2H3,(H,22,27)(H,23,30) |
| InChIKey | SUWAJMSMFPCFAA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|