C17H16Cl3N3O4 — CID 46629727
[1-(2-ethoxyanilino)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 46629727) has the molecular formula C17H16Cl3N3O4 and a molecular weight of 432.69 g/mol. Its IUPAC name is [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 46629727 |
| Molecular Formula | C17H16Cl3N3O4 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)C(C)OC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C17H16Cl3N3O4/c1-3-26-10-7-5-4-6-9(10)22-16(24)8(2)27-17(25)14-11(18)13(21)12(19)15(20)23-14/h4-8H,3H2,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | JMBAWJKOAORPQZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|