C13H16F2N2O2 — CID 46630811
N-(3,4-difluorophenyl)-2-morpholin-4-ylpropanamide (PubChem CID 46630811) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-morpholin-4-ylpropanamide.
| Compound Name | N-(3,4-difluorophenyl)-2-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 46630811 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-morpholin-4-ylpropanamide |
| SMILES | CC(C(=O)Nc1ccc(F)c(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-9(17-4-6-19-7-5-17)13(18)16-10-2-3-11(14)12(15)8-10/h2-3,8-9H,4-7H2,1H3,(H,16,18) |
| InChIKey | LPVXWBHUTHOSRC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |