C15H13ClF3N5O3 — CID 46632262
5-chloro-4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 46632262) has the molecular formula C15H13ClF3N5O3 and a molecular weight of 403.75 g/mol. Its IUPAC name is 5-chloro-4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 46632262 |
| Molecular Formula | C15H13ClF3N5O3 |
| Molecular Weight | 403.75 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 5-chloro-4-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)c1Cl |
| InChI | InChI=1S/C15H13ClF3N5O3/c16-13-12(8-20-21-14(13)25)23-5-3-22(4-6-23)10-2-1-9(15(17,18)19)7-11(10)24(26)27/h1-2,7-8H,3-6H2,(H,21,25) |
| InChIKey | UURPBSYKFCBLJT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|