About 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione
4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione (PubChem CID 4663233) has the molecular formula C16H15NOS
and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione |
| PubChem CID | 4663233 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione |
| SMILES | CN1CC(c2ccccc2)Oc2ccccc2C1=S |
| InChI | InChI=1S/C16H15NOS/c1-17-11-15(12-7-3-2-4-8-12)18-14-10-6-5-9-13(14)16(17)19/h2-10,15H,11H2,1H3 |
| InChIKey | CCLHOFSFMNPQPV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione?
The IUPAC name of 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione (CID 4663233) is 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione.
What is the SMILES notation for 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione?
The canonical SMILES for 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione is CN1CC(c2ccccc2)Oc2ccccc2C1=S.
What is the InChIKey of 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione?
The InChIKey is CCLHOFSFMNPQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NOS/c1-17-11-15(12-7-3-2-4-8-12)18-14-10-6-5-9-13(14)16(17)19/h2-10,15H,11H2,1H3.
What are the key properties of 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione?
4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione has a molecular weight of 269.37 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-2,3-dihydro-1,4-benzoxazepine-5-thione is sourced from PubChem (CID 4663233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).