C16H18ClNO2S — CID 46632667
5-chloro-N-[3-(1-phenylethoxy)propyl]thiophene-2-carboxamide (PubChem CID 46632667) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is 5-chloro-N-[3-(1-phenylethoxy)propyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[3-(1-phenylethoxy)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46632667 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-chloro-N-[3-(1-phenylethoxy)propyl]thiophene-2-carboxamide |
| SMILES | CC(OCCCNC(=O)c1ccc(Cl)s1)c1ccccc1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-12(13-6-3-2-4-7-13)20-11-5-10-18-16(19)14-8-9-15(17)21-14/h2-4,6-9,12H,5,10-11H2,1H3,(H,18,19) |
| InChIKey | CDOXOCUZZTZZFN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|