C24H22N4O3S — CID 46637923
N-[(1-benzylpyrazol-4-yl)methyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylacetamide (PubChem CID 46637923) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylacetamide.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 46637923 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-methylacetamide |
| SMILES | CN(Cc1cnn(Cc2ccccc2)c1)C(=O)CN1c2cccc3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C24H22N4O3S/c1-26(14-19-13-25-27(16-19)15-18-7-3-2-4-8-18)23(29)17-28-21-11-5-9-20-10-6-12-22(24(20)21)32(28,30)31/h2-13,16H,14-15,17H2,1H3 |
| InChIKey | RGWSWVFNCHVRQM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |