C19H23Cl2N3O3 — CID 46638454
5-(3,4-dichlorophenyl)-3-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 46638454) has the molecular formula C19H23Cl2N3O3 and a molecular weight of 412.32 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dichlorophenyl)-3-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46638454 |
| Molecular Formula | C19H23Cl2N3O3 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCC1CCCCN1C(=O)CN1C(=O)NC(C)(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H23Cl2N3O3/c1-3-13-6-4-5-9-23(13)16(25)11-24-17(26)19(2,22-18(24)27)12-7-8-14(20)15(21)10-12/h7-8,10,13H,3-6,9,11H2,1-2H3,(H,22,27) |
| InChIKey | APEYCUACXYIORH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|