C16H10FIN2O3 — CID 46638792
5-(4-fluorophenyl)-3-[2-(4-iodophenyl)-2-oxoethyl]-1,3,4-oxadiazol-2-one (PubChem CID 46638792) has the molecular formula C16H10FIN2O3 and a molecular weight of 424.17 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[2-(4-iodophenyl)-2-oxoethyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(4-fluorophenyl)-3-[2-(4-iodophenyl)-2-oxoethyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 46638792 |
| Molecular Formula | C16H10FIN2O3 |
| Molecular Weight | 424.17 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[2-(4-iodophenyl)-2-oxoethyl]-1,3,4-oxadiazol-2-one |
| SMILES | O=C(Cn1nc(-c2ccc(F)cc2)oc1=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H10FIN2O3/c17-12-5-1-11(2-6-12)15-19-20(16(22)23-15)9-14(21)10-3-7-13(18)8-4-10/h1-8H,9H2 |
| InChIKey | SUUGLXCNKDFTNK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|