C16H19Cl2N5OS — CID 46639260
2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,5-dichlorophenyl)propanamide (PubChem CID 46639260) has the molecular formula C16H19Cl2N5OS and a molecular weight of 400.34 g/mol. Its IUPAC name is 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 46639260 |
| Molecular Formula | C16H19Cl2N5OS |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-(2,5-dichlorophenyl)propanamide |
| SMILES | CC(Sc1nnnn1C1CCCCC1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H19Cl2N5OS/c1-10(15(24)19-14-9-11(17)7-8-13(14)18)25-16-20-21-22-23(16)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,19,24) |
| InChIKey | VRLSECWHBSSXRM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |