C20H21N3O4S — CID 4664067
2-(4-methoxyphenyl)imino-3-methyl-5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 4664067) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)imino-3-methyl-5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-methoxyphenyl)imino-3-methyl-5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4664067 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(4-methoxyphenyl)imino-3-methyl-5-[(5-morpholin-4-ylfuran-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2/SC(=Cc3ccc(N4CCOCC4)o3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-22-19(24)17(28-20(22)21-14-3-5-15(25-2)6-4-14)13-16-7-8-18(27-16)23-9-11-26-12-10-23/h3-8,13H,9-12H2,1-2H3/b17-13?,21-20+ |
| InChIKey | ITGLXYVOQWXAGU-KXWSGKLSSA-N |
| XLogP | 3.36 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|