C27H25N3O5S — CID 4664179
(2,5-dioxo-1-phenylpyrrolidin-3-yl) N'-(1,3-benzodioxol-5-ylmethyl)-N-(4-ethoxyphenyl)carbamimidothioate (PubChem CID 4664179) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is (2,5-dioxo-1-phenylpyrrolidin-3-yl) N'-(1,3-benzodioxol-5-ylmethyl)-N-(4-ethoxyphenyl)carbamimidothioate.
| Compound Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) N'-(1,3-benzodioxol-5-ylmethyl)-N-(4-ethoxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 4664179 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) N'-(1,3-benzodioxol-5-ylmethyl)-N-(4-ethoxyphenyl)carbamimidothioate |
| SMILES | CCOc1ccc(N/C(=N/Cc2ccc3c(c2)OCO3)SC2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O5S/c1-2-33-21-11-9-19(10-12-21)29-27(28-16-18-8-13-22-23(14-18)35-17-34-22)36-24-15-25(31)30(26(24)32)20-6-4-3-5-7-20/h3-14,24H,2,15-17H2,1H3,(H,28,29) |
| InChIKey | JLJGOMNYIRFYSM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|