C20H23N5O5 — CID 46641798
N-[(3,4-dimethylphenyl)carbamoyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 46641798) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)carbamoyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 46641798 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NC(=O)Nc2ccc(C)c(C)c2)c1=O |
| InChI | InChI=1S/C20H23N5O5/c1-5-9-23-18(28)24(10-6-2)20(30)25(19(23)29)12-16(26)22-17(27)21-15-8-7-13(3)14(4)11-15/h5-8,11H,1-2,9-10,12H2,3-4H3,(H2,21,22,26,27) |
| InChIKey | MWYAERGIGAOWBK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|