About 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone
2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone (PubChem CID 4664256) has the molecular formula C18H12N2O2S
and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone |
| PubChem CID | 4664256 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone |
| SMILES | O=C(CSc1ncnc2c1oc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C18H12N2O2S/c21-14(12-6-2-1-3-7-12)10-23-18-17-16(19-11-20-18)13-8-4-5-9-15(13)22-17/h1-9,11H,10H2 |
| InChIKey | JRZPURRSSLFOQX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone?
The IUPAC name of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone (CID 4664256) is 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone.
What is the SMILES notation for 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone?
The canonical SMILES for 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone is O=C(CSc1ncnc2c1oc1ccccc12)c1ccccc1.
What is the InChIKey of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone?
The InChIKey is JRZPURRSSLFOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2S/c21-14(12-6-2-1-3-7-12)10-23-18-17-16(19-11-20-18)13-8-4-5-9-15(13)22-17/h1-9,11H,10H2.
What are the key properties of 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone?
2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone has a molecular weight of 320.37 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1]benzofuro[3,2-d]pyrimidin-4-ylsulfanyl)-1-phenylethanone is sourced from PubChem (CID 4664256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).