About 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid
4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid (PubChem CID 4664354) has the molecular formula C16H15N3O4S2
and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid.
Molecular Properties
| Compound Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid |
| PubChem CID | 4664354 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid |
| SMILES | O=C(O)CC(CNS(=O)(=O)c1cccc2nsnc12)c1ccccc1 |
| InChI | InChI=1S/C16H15N3O4S2/c20-15(21)9-12(11-5-2-1-3-6-11)10-17-25(22,23)14-8-4-7-13-16(14)19-24-18-13/h1-8,12,17H,9-10H2,(H,20,21) |
| InChIKey | VUMAYFRPKADKME-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid?
The IUPAC name of 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid (CID 4664354) is 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid.
What is the SMILES notation for 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid?
The canonical SMILES for 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid is O=C(O)CC(CNS(=O)(=O)c1cccc2nsnc12)c1ccccc1.
What is the InChIKey of 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid?
The InChIKey is VUMAYFRPKADKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O4S2/c20-15(21)9-12(11-5-2-1-3-6-11)10-17-25(22,23)14-8-4-7-13-16(14)19-24-18-13/h1-8,12,17H,9-10H2,(H,20,21).
What are the key properties of 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid?
4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid has a molecular weight of 377.45 g/mol, XLogP of 2.23, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-3-phenylbutanoic acid is sourced from PubChem (CID 4664354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).