C22H21N3O2S2 — CID 46644851
1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propan-1-one (PubChem CID 46644851) has the molecular formula C22H21N3O2S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propan-1-one.
| Compound Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 46644851 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)propan-1-one |
| SMILES | CC(=O)N1CCc2cc(C(=O)C(C)Sc3ncnc4sc5c(c34)CCC5)ccc21 |
| InChI | InChI=1S/C22H21N3O2S2/c1-12(20(27)15-6-7-17-14(10-15)8-9-25(17)13(2)26)28-21-19-16-4-3-5-18(16)29-22(19)24-11-23-21/h6-7,10-12H,3-5,8-9H2,1-2H3 |
| InChIKey | IRZDKJPHCJHRFV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |