C21H23FN2O5S — CID 46646743
[1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 46646743) has the molecular formula C21H23FN2O5S and a molecular weight of 434.49 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 46646743 |
| Molecular Formula | C21H23FN2O5S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O5S/c1-15(20(25)23-14-16-7-9-18(22)10-8-16)29-21(26)17-5-4-6-19(13-17)30(27,28)24-11-2-3-12-24/h4-10,13,15H,2-3,11-12,14H2,1H3,(H,23,25) |
| InChIKey | UUTRBVLTJAYEGZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |