C19H18Cl2N2O4S — CID 46647839
ethyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate (PubChem CID 46647839) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46647839 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | ethyl 2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)sc(C(=O)NC)c1C |
| InChI | InChI=1S/C19H18Cl2N2O4S/c1-4-27-19(26)15-10(2)16(17(25)22-3)28-18(15)23-14(24)8-6-11-5-7-12(20)13(21)9-11/h5-9H,4H2,1-3H3,(H,22,25)(H,23,24)/b8-6+ |
| InChIKey | SCFWCNIAWLURGO-SOFGYWHQSA-N |
| XLogP | 4.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|