C20H18FN3O2S — CID 46648236
(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 46648236) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46648236 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | Nc1nc(COC(=O)/C=C/c2cccc(F)c2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C20H18FN3O2S/c21-13-5-3-4-12(10-13)8-9-17(25)26-11-16-23-19(22)18-14-6-1-2-7-15(14)27-20(18)24-16/h3-5,8-10H,1-2,6-7,11H2,(H2,22,23,24)/b9-8+ |
| InChIKey | WFTOTQOXVZNWQK-CMDGGOBGSA-N |
| XLogP | 4.05 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|