C15H18N6OS — CID 46648435
N-(3-cyanophenyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 46648435) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(3-cyanophenyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46648435 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-(3-cyanophenyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(C)Cn1nnnc1SC(C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N6OS/c1-10(2)9-21-15(18-19-20-21)23-11(3)14(22)17-13-6-4-5-12(7-13)8-16/h4-7,10-11H,9H2,1-3H3,(H,17,22) |
| InChIKey | JNXKLADMZFTLNH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |