C24H29N5O5 — CID 46648614
[2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate (PubChem CID 46648614) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is [2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate.
| Compound Name | [2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate |
|---|---|
| PubChem CID | 46648614 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [2-oxo-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl] 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoate |
| SMILES | CC(NC(=O)COC(=O)CCn1cnc2c1c(=O)n(C)c(=O)n2C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H29N5O5/c1-15(17-9-8-16-6-4-5-7-18(16)12-17)26-19(30)13-34-20(31)10-11-29-14-25-22-21(29)23(32)28(3)24(33)27(22)2/h8-9,12,14-15H,4-7,10-11,13H2,1-3H3,(H,26,30) |
| InChIKey | QDNAEIQAUFABJU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |