C20H18N2O4S — CID 46649516
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 46649516) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46649516 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C20H18N2O4S/c23-20(21-7-6-14-4-5-18-19(8-14)26-13-25-18)15-2-1-3-17(9-15)24-10-16-11-27-12-22-16/h1-5,8-9,11-12H,6-7,10,13H2,(H,21,23) |
| InChIKey | WRRXTUBIEWQERQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |