C20H20N4O5S2 — CID 4665062
N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 4665062) has the molecular formula C20H20N4O5S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4665062 |
| Molecular Formula | C20H20N4O5S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | COc1cc(NC(=O)CSc2nc3sc4c(c3c(=O)[nH]2)CCCC4)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O5S2/c1-10-7-13(24(27)28)14(29-2)8-12(10)21-16(25)9-30-20-22-18(26)17-11-5-3-4-6-15(11)31-19(17)23-20/h7-8H,3-6,9H2,1-2H3,(H,21,25)(H,22,23,26) |
| InChIKey | QXYGJWFDFGFAFD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|