C20H15F3N6O3 — CID 4665090
N-[2-[[1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazol-5-yl]amino]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 4665090) has the molecular formula C20H15F3N6O3 and a molecular weight of 444.37 g/mol. Its IUPAC name is N-[2-[[1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazol-5-yl]amino]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[[1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazol-5-yl]amino]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 4665090 |
| Molecular Formula | C20H15F3N6O3 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[2-[[1-(2-cyanoethyl)-3-(4-nitrophenyl)pyrazol-5-yl]amino]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | N#CCCn1nc(-c2ccc([N+](=O)[O-])cc2)cc1Nc1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H15F3N6O3/c21-20(22,23)19(30)26-16-5-2-1-4-15(16)25-18-12-17(27-28(18)11-3-10-24)13-6-8-14(9-7-13)29(31)32/h1-2,4-9,12,25H,3,11H2,(H,26,30) |
| InChIKey | JNZUWRKGDZJFDF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|