C24H25N5O4S — CID 46650936
2-(4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-N-[4-[[(2-phenylacetyl)amino]carbamoyl]phenyl]acetamide (PubChem CID 46650936) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-(4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-N-[4-[[(2-phenylacetyl)amino]carbamoyl]phenyl]acetamide.
| Compound Name | 2-(4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-N-[4-[[(2-phenylacetyl)amino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46650936 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-(4-oxo-2-pyrrolidin-1-yl-1,3-thiazol-5-yl)-N-[4-[[(2-phenylacetyl)amino]carbamoyl]phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)c1ccc(NC(=O)CC2SC(N3CCCC3)=NC2=O)cc1 |
| InChI | InChI=1S/C24H25N5O4S/c30-20(15-19-23(33)26-24(34-19)29-12-4-5-13-29)25-18-10-8-17(9-11-18)22(32)28-27-21(31)14-16-6-2-1-3-7-16/h1-3,6-11,19H,4-5,12-15H2,(H,25,30)(H,27,31)(H,28,32) |
| InChIKey | HVSCMNRVVHTNKN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|