C25H23ClN4O — CID 46651328
[4-(3-chlorophenyl)piperazin-1-yl]-(2-methyl-1-phenylbenzimidazol-5-yl)methanone (PubChem CID 46651328) has the molecular formula C25H23ClN4O and a molecular weight of 430.94 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(2-methyl-1-phenylbenzimidazol-5-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(2-methyl-1-phenylbenzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 46651328 |
| Molecular Formula | C25H23ClN4O |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(2-methyl-1-phenylbenzimidazol-5-yl)methanone |
| SMILES | Cc1nc2cc(C(=O)N3CCN(c4cccc(Cl)c4)CC3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H23ClN4O/c1-18-27-23-16-19(10-11-24(23)30(18)21-7-3-2-4-8-21)25(31)29-14-12-28(13-15-29)22-9-5-6-20(26)17-22/h2-11,16-17H,12-15H2,1H3 |
| InChIKey | RQYZDMLHZDWFSU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |