C17H16Cl2N4O3S — CID 46652645
ethyl N-[[1-[(2,4-dichlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]carbamate (PubChem CID 46652645) has the molecular formula C17H16Cl2N4O3S and a molecular weight of 427.31 g/mol. Its IUPAC name is ethyl N-[[1-[(2,4-dichlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[1-[(2,4-dichlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 46652645 |
| Molecular Formula | C17H16Cl2N4O3S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | ethyl N-[[1-[(2,4-dichlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1cc2c(C)nn(Cc3ccc(Cl)cc3Cl)c2s1 |
| InChI | InChI=1S/C17H16Cl2N4O3S/c1-3-26-17(25)21-20-15(24)14-7-12-9(2)22-23(16(12)27-14)8-10-4-5-11(18)6-13(10)19/h4-7H,3,8H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | JZXPXBYDJJTTRL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|