About 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide (PubChem CID 46654113) has the molecular formula C20H17BrClFN2O3
and a molecular weight of 467.72 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide |
| PubChem CID | 46654113 |
| Molecular Formula | C20H17BrClFN2O3 |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C20H17BrClFN2O3/c1-24(11-15-16(22)4-2-5-17(15)23)18(26)6-3-9-25-19(27)13-8-7-12(21)10-14(13)20(25)28/h2,4-5,7-8,10H,3,6,9,11H2,1H3 |
| InChIKey | KSZCHOWROJDEAA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide?
The IUPAC name of 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide (CID 46654113) is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide.
What is the SMILES notation for 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide?
The canonical SMILES for 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide is CN(Cc1c(F)cccc1Cl)C(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O.
What is the InChIKey of 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide?
The InChIKey is KSZCHOWROJDEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BrClFN2O3/c1-24(11-15-16(22)4-2-5-17(15)23)18(26)6-3-9-25-19(27)13-8-7-12(21)10-14(13)20(25)28/h2,4-5,7-8,10H,3,6,9,11H2,1H3.
What are the key properties of 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide?
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide has a molecular weight of 467.72 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylbutanamide is sourced from PubChem (CID 46654113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).