C18H15Cl2FN4O2S — CID 46656410
7-[[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 46656410) has the molecular formula C18H15Cl2FN4O2S and a molecular weight of 441.32 g/mol. Its IUPAC name is 7-[[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 46656410 |
| Molecular Formula | C18H15Cl2FN4O2S |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 7-[[4-(2,4-dichloro-5-fluorobenzoyl)piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=C(c1cc(F)c(Cl)cc1Cl)N1CCN(Cc2cc(=O)n3ccsc3n2)CC1 |
| InChI | InChI=1S/C18H15Cl2FN4O2S/c19-13-9-14(20)15(21)8-12(13)17(27)24-3-1-23(2-4-24)10-11-7-16(26)25-5-6-28-18(25)22-11/h5-9H,1-4,10H2 |
| InChIKey | ADNATABAWDOCGP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|