C25H19N7O3 — CID 46657487
N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide (PubChem CID 46657487) has the molecular formula C25H19N7O3 and a molecular weight of 465.47 g/mol. Its IUPAC name is N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide.
| Compound Name | N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46657487 |
| Molecular Formula | C25H19N7O3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2)cc1O)c1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C25H19N7O3/c33-21-16-32(19-11-5-2-6-12-19)30-23(21)25(35)28-27-24(34)20-15-31(18-9-3-1-4-10-18)29-22(20)17-8-7-13-26-14-17/h1-16,33H,(H,27,34)(H,28,35) |
| InChIKey | MCJGDQRZKPCZDP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|