C20H18N4O2 — CID 4665815
5-amino-7-(2,4-dimethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile (PubChem CID 4665815) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5-amino-7-(2,4-dimethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile.
| Compound Name | 5-amino-7-(2,4-dimethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
|---|---|
| PubChem CID | 4665815 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5-amino-7-(2,4-dimethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
| SMILES | COc1ccc(C2C3CCC=C3C(C#N)=C(N)C2(C#N)C#N)c(OC)c1 |
| InChI | InChI=1S/C20H18N4O2/c1-25-12-6-7-15(17(8-12)26-2)18-14-5-3-4-13(14)16(9-21)19(24)20(18,10-22)11-23/h4,6-8,14,18H,3,5,24H2,1-2H3 |
| InChIKey | SBIMLFLLINPJFB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|