C18H23N7O2S — CID 46658701
6-[1-[[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 46658701) has the molecular formula C18H23N7O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is 6-[1-[[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46658701 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 6-[1-[[5-[(2,5-dimethylphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(C)c(OCc2nnc(SC(C)c3nc(N)nc(N(C)C)n3)o2)c1 |
| InChI | InChI=1S/C18H23N7O2S/c1-10-6-7-11(2)13(8-10)26-9-14-23-24-18(27-14)28-12(3)15-20-16(19)22-17(21-15)25(4)5/h6-8,12H,9H2,1-5H3,(H2,19,20,21,22) |
| InChIKey | UGVJUWSJBAKSDI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |