C19H19F2NO4S — CID 46659301
(2-fluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate (PubChem CID 46659301) has the molecular formula C19H19F2NO4S and a molecular weight of 395.43 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (2-fluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 46659301 |
| Molecular Formula | C19H19F2NO4S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2-fluorophenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1F)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H19F2NO4S/c20-16-7-9-17(10-8-16)27(24,25)22-11-3-5-14(12-22)19(23)26-13-15-4-1-2-6-18(15)21/h1-2,4,6-10,14H,3,5,11-13H2 |
| InChIKey | PEQQOIAKPDOXLX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |