C27H26N2O4 — CID 46659550
[2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetate (PubChem CID 46659550) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetate.
| Compound Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetate |
|---|---|
| PubChem CID | 46659550 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] 2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)Cc2ccc(N3CCCC3=O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-19-9-13-22(14-10-19)28-27(32)26(21-6-3-2-4-7-21)33-25(31)18-20-11-15-23(16-12-20)29-17-5-8-24(29)30/h2-4,6-7,9-16,26H,5,8,17-18H2,1H3,(H,28,32) |
| InChIKey | DHAALYGKFVQGFP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |