C27H25FN2O5 — CID 46662282
[4-[(2-methoxybenzoyl)amino]phenyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate (PubChem CID 46662282) has the molecular formula C27H25FN2O5 and a molecular weight of 476.50 g/mol. Its IUPAC name is [4-[(2-methoxybenzoyl)amino]phenyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate.
| Compound Name | [4-[(2-methoxybenzoyl)amino]phenyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46662282 |
| Molecular Formula | C27H25FN2O5 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [4-[(2-methoxybenzoyl)amino]phenyl] 1-(4-fluorobenzoyl)piperidine-3-carboxylate |
| SMILES | COc1ccccc1C(=O)Nc1ccc(OC(=O)C2CCCN(C(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C27H25FN2O5/c1-34-24-7-3-2-6-23(24)25(31)29-21-12-14-22(15-13-21)35-27(33)19-5-4-16-30(17-19)26(32)18-8-10-20(28)11-9-18/h2-3,6-15,19H,4-5,16-17H2,1H3,(H,29,31) |
| InChIKey | GEZJQLTYDBFTKW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|