C25H28FN3O3S — CID 46663203
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-[1-(4-fluorophenyl)ethyl-methylamino]acetamide (PubChem CID 46663203) has the molecular formula C25H28FN3O3S and a molecular weight of 469.58 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-[1-(4-fluorophenyl)ethyl-methylamino]acetamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-[1-(4-fluorophenyl)ethyl-methylamino]acetamide |
|---|---|
| PubChem CID | 46663203 |
| Molecular Formula | C25H28FN3O3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2-[1-(4-fluorophenyl)ethyl-methylamino]acetamide |
| SMILES | CC(c1ccc(F)cc1)N(C)CC(=O)Nc1ccc(S(=O)(=O)N(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28FN3O3S/c1-19(21-9-11-22(26)12-10-21)28(2)18-25(30)27-23-13-15-24(16-14-23)33(31,32)29(3)17-20-7-5-4-6-8-20/h4-16,19H,17-18H2,1-3H3,(H,27,30) |
| InChIKey | CBAJGPSUDBXBOK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |