C24H23FN4O4S — CID 46663815
3-[[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide (PubChem CID 46663815) has the molecular formula C24H23FN4O4S and a molecular weight of 482.54 g/mol. Its IUPAC name is 3-[[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide.
| Compound Name | 3-[[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46663815 |
| Molecular Formula | C24H23FN4O4S |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3-[[[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]carbamoyl]-N-(4-fluorophenyl)benzenesulfonamide |
| SMILES | O=C(CN1CCCc2ccccc21)NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H23FN4O4S/c25-19-10-12-20(13-11-19)28-34(32,33)21-8-3-6-18(15-21)24(31)27-26-23(30)16-29-14-4-7-17-5-1-2-9-22(17)29/h1-3,5-6,8-13,15,28H,4,7,14,16H2,(H,26,30)(H,27,31) |
| InChIKey | MOVVHTIJIQDOFZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|