C22H28N2O4 — CID 46664174
ethyl 4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]benzoate (PubChem CID 46664174) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]benzoate.
| Compound Name | ethyl 4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 46664174 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | ethyl 4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(O)CN2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-2-27-22(26)18-8-10-21(11-9-18)28-17-20(25)16-23-12-14-24(15-13-23)19-6-4-3-5-7-19/h3-11,20,25H,2,12-17H2,1H3 |
| InChIKey | CWUTYGFBDZLUHC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |