C24H22N2O4S2 — CID 46664819
2-(3-methoxypropyl)-5-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)isoindole-1,3-dione (PubChem CID 46664819) has the molecular formula C24H22N2O4S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-5-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-(3-methoxypropyl)-5-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 46664819 |
| Molecular Formula | C24H22N2O4S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-(3-methoxypropyl)-5-(4-thiophen-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)N3CCc4sccc4C3c3cccs3)cc2C1=O |
| InChI | InChI=1S/C24H22N2O4S2/c1-30-11-3-9-26-23(28)16-6-5-15(14-18(16)24(26)29)22(27)25-10-7-19-17(8-13-32-19)21(25)20-4-2-12-31-20/h2,4-6,8,12-14,21H,3,7,9-11H2,1H3 |
| InChIKey | PBNQGQYENCMZIY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|