C19H13Cl2F3N4O2 — CID 46665346
N-(4-amino-3,5-dichlorophenyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 46665346) has the molecular formula C19H13Cl2F3N4O2 and a molecular weight of 457.24 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46665346 |
| Molecular Formula | C19H13Cl2F3N4O2 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cc(Cl)c(N)c(Cl)c2)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H13Cl2F3N4O2/c1-9-6-15(29)17(18(30)26-10-7-12(20)16(25)13(21)8-10)27-28(9)14-5-3-2-4-11(14)19(22,23)24/h2-8H,25H2,1H3,(H,26,30) |
| InChIKey | YEZKKONRJMDQEB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|