C18H16ClN3O4 — CID 46665438
N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetamide (PubChem CID 46665438) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 46665438 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)oc1=O)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O4/c19-14-6-8-15(9-7-14)25-11-10-20-16(23)12-22-18(24)26-17(21-22)13-4-2-1-3-5-13/h1-9H,10-12H2,(H,20,23) |
| InChIKey | XSVSXMBQMIUNID-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|