C20H19BrClN3O5 — CID 46665897
2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 46665897) has the molecular formula C20H19BrClN3O5 and a molecular weight of 496.75 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46665897 |
| Molecular Formula | C20H19BrClN3O5 |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CN2C(=O)NC(C)(c3cccc(Br)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C20H19BrClN3O5/c1-20(11-5-4-6-12(21)7-11)18(27)25(19(28)24-20)10-17(26)23-14-8-13(22)15(29-2)9-16(14)30-3/h4-9H,10H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | JDGXHLINLZYPRN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|