C18H19N3O2S3 — CID 46666436
2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 46666436) has the molecular formula C18H19N3O2S3 and a molecular weight of 405.57 g/mol. Its IUPAC name is 2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 46666436 |
| Molecular Formula | C18H19N3O2S3 |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CSc2nc3ccsc3c(=O)n2C)cc1 |
| InChI | InChI=1S/C18H19N3O2S3/c1-12-3-5-13(6-4-12)24-10-8-19-15(22)11-26-18-20-14-7-9-25-16(14)17(23)21(18)2/h3-7,9H,8,10-11H2,1-2H3,(H,19,22) |
| InChIKey | URPKVRJOAPCEJJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|