C20H30N4O3S — CID 46666978
N-cyclohexyl-3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-methylpropanamide (PubChem CID 46666978) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-cyclohexyl-3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-methylpropanamide.
| Compound Name | N-cyclohexyl-3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 46666978 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-cyclohexyl-3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]-N-methylpropanamide |
| SMILES | CN(C(=O)CCc1nc2cc(S(=O)(=O)N(C)C)ccc2n1C)C1CCCCC1 |
| InChI | InChI=1S/C20H30N4O3S/c1-22(2)28(26,27)16-10-11-18-17(14-16)21-19(24(18)4)12-13-20(25)23(3)15-8-6-5-7-9-15/h10-11,14-15H,5-9,12-13H2,1-4H3 |
| InChIKey | KIAGRIVMMXZOOM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |