C19H30N2O4 — CID 46667184
ethyl 5-(3-cyclohexyloxypropylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 46667184) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl 5-(3-cyclohexyloxypropylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-(3-cyclohexyloxypropylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46667184 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | ethyl 5-(3-cyclohexyloxypropylcarbamoyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)NCCCOC2CCCCC2)c1C |
| InChI | InChI=1S/C19H30N2O4/c1-4-24-19(23)16-13(2)17(21-14(16)3)18(22)20-11-8-12-25-15-9-6-5-7-10-15/h15,21H,4-12H2,1-3H3,(H,20,22) |
| InChIKey | XZQVSQIAOZMFJA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|