C28H26N4O — CID 4666880
4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(2-methyl-1H-indol-3-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene (PubChem CID 4666880) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(2-methyl-1H-indol-3-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene.
| Compound Name | 4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(2-methyl-1H-indol-3-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 4666880 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(2-methyl-1H-indol-3-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
| SMILES | COc1ccc(-n2c(C)c3c(C)nn4cc(-c5c(C)[nH]c6ccccc56)cc4c3c2C)cc1 |
| InChI | InChI=1S/C28H26N4O/c1-16-27(23-8-6-7-9-24(23)29-16)20-14-25-28-19(4)32(21-10-12-22(33-5)13-11-21)18(3)26(28)17(2)30-31(25)15-20/h6-15,29H,1-5H3 |
| InChIKey | JGKYWLXQRJTEQW-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 47.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |