C11H13N3S — CID 4666902
3-thiophen-3-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine (PubChem CID 4666902) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 3-thiophen-3-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine.
| Compound Name | 3-thiophen-3-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 4666902 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-thiophen-3-yl-2,4,5,6,7,8-hexahydropyrazolo[3,4-b]azepine |
| SMILES | c1cc(-c2[nH]nc3c2CCCCN3)cs1 |
| InChI | InChI=1S/C11H13N3S/c1-2-5-12-11-9(3-1)10(13-14-11)8-4-6-15-7-8/h4,6-7H,1-3,5H2,(H2,12,13,14) |
| InChIKey | NAAHVKVRWPKUFE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |